C11H19N2+ — CID 12924167
1-hexylpyridin-1-ium-2-amine (PubChem CID 12924167) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is 1-hexylpyridin-1-ium-2-amine.
| Compound Name | 1-hexylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 12924167 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | 1-hexylpyridin-1-ium-2-amine |
| SMILES | CCCCCC[n+]1ccccc1N |
| InChI | InChI=1S/C11H18N2/c1-2-3-4-6-9-13-10-7-5-8-11(13)12/h5,7-8,10,12H,2-4,6,9H2,1H3/p+1 |
| InChIKey | UGZCUGYVZSCAGJ-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|