C23H42ClN — CID 67784709
1-decyl-2-octylpyridin-1-ium chloride (PubChem CID 67784709) has the molecular formula C23H42ClN and a molecular weight of 368.05 g/mol. Its IUPAC name is 1-decyl-2-octylpyridin-1-ium chloride.
| Compound Name | 1-decyl-2-octylpyridin-1-ium chloride |
|---|---|
| PubChem CID | 67784709 |
| Molecular Formula | C23H42ClN |
| Molecular Weight | 368.05 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | 1-decyl-2-octylpyridin-1-ium chloride |
| SMILES | CCCCCCCCCC[n+]1ccccc1CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C23H42N.ClH/c1-3-5-7-9-11-12-14-17-21-24-22-18-16-20-23(24)19-15-13-10-8-6-4-2;/h16,18,20,22H,3-15,17,19,21H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | AJWATBOIHGCWHN-UHFFFAOYSA-M |
| XLogP | 4.02 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|