C15H26FN — CID 171570135
1-heptyl-2-propylpyridin-1-ium fluoride (PubChem CID 171570135) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is 1-heptyl-2-propylpyridin-1-ium fluoride.
| Compound Name | 1-heptyl-2-propylpyridin-1-ium fluoride |
|---|---|
| PubChem CID | 171570135 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-heptyl-2-propylpyridin-1-ium fluoride |
| SMILES | CCCCCCC[n+]1ccccc1CCC.[F-] |
| InChI | InChI=1S/C15H26N.FH/c1-3-5-6-7-9-13-16-14-10-8-12-15(16)11-4-2;/h8,10,12,14H,3-7,9,11,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VKWYZGIERLCYGK-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|