1-heptyl-2-propylpyridin-1-ium fluoride

C15H26FN — CID 171570135

IUPAC1-heptyl-2-propylpyridin-1-ium fluoride
SMILESCCCCCCC[n+]1ccccc1CCC.[F-]
InChIInChI=1S/C15H26N.FH/c1-3-5-6-7-9-13-16-14-10-8-12-15(16)11-4-2;/h8,10,12,14H,3-7,9,11,13H2,1-2H3;1H/q+1;/p-1
InChIKeyVKWYZGIERLCYGK-UHFFFAOYSA-M
MW239.38 g/mol
LogP0.90
Rot. Bonds8

About 1-heptyl-2-propylpyridin-1-ium fluoride

1-heptyl-2-propylpyridin-1-ium fluoride (PubChem CID 171570135) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is 1-heptyl-2-propylpyridin-1-ium fluoride.

Molecular Properties

Compound Name1-heptyl-2-propylpyridin-1-ium fluoride
PubChem CID171570135
Molecular FormulaC15H26FN
Molecular Weight239.38 g/mol
Exact Mass239.20
IUPAC Name1-heptyl-2-propylpyridin-1-ium fluoride
SMILESCCCCCCC[n+]1ccccc1CCC.[F-]
InChIInChI=1S/C15H26N.FH/c1-3-5-6-7-9-13-16-14-10-8-12-15(16)11-4-2;/h8,10,12,14H,3-7,9,11,13H2,1-2H3;1H/q+1;/p-1
InChIKeyVKWYZGIERLCYGK-UHFFFAOYSA-M
XLogP0.90
TPSA3.88 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds8
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.38
LogP ≤ 50.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1-heptyl-2-propylpyridin-1-ium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-heptyl-2-propylpyridin-1-ium fluoride?
The IUPAC name of 1-heptyl-2-propylpyridin-1-ium fluoride (CID 171570135) is 1-heptyl-2-propylpyridin-1-ium fluoride.
What is the SMILES notation for 1-heptyl-2-propylpyridin-1-ium fluoride?
The canonical SMILES for 1-heptyl-2-propylpyridin-1-ium fluoride is CCCCCCC[n+]1ccccc1CCC.[F-].
What is the InChIKey of 1-heptyl-2-propylpyridin-1-ium fluoride?
The InChIKey is VKWYZGIERLCYGK-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H26N.FH/c1-3-5-6-7-9-13-16-14-10-8-12-15(16)11-4-2;/h8,10,12,14H,3-7,9,11,13H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-heptyl-2-propylpyridin-1-ium fluoride?
1-heptyl-2-propylpyridin-1-ium fluoride has a molecular weight of 239.38 g/mol, XLogP of 0.90, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-2-propylpyridin-1-ium fluoride is sourced from PubChem (CID 171570135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).