C15H22Br2N4 — CID 138811091
1-[5-(2-aminopyridin-1-ium-1-yl)pentyl]pyridin-1-ium-2-amine dibromide (PubChem CID 138811091) has the molecular formula C15H22Br2N4 and a molecular weight of 418.18 g/mol. Its IUPAC name is 1-[5-(2-aminopyridin-1-ium-1-yl)pentyl]pyridin-1-ium-2-amine dibromide.
| Compound Name | 1-[5-(2-aminopyridin-1-ium-1-yl)pentyl]pyridin-1-ium-2-amine dibromide |
|---|---|
| PubChem CID | 138811091 |
| Molecular Formula | C15H22Br2N4 |
| Molecular Weight | 418.18 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 1-[5-(2-aminopyridin-1-ium-1-yl)pentyl]pyridin-1-ium-2-amine dibromide |
| SMILES | Nc1cccc[n+]1CCCCC[n+]1ccccc1N.[Br-].[Br-] |
| InChI | InChI=1S/C15H20N4.2BrH/c16-14-8-2-6-12-18(14)10-4-1-5-11-19-13-7-3-9-15(19)17;;/h2-3,6-9,12-13,16-17H,1,4-5,10-11H2;2*1H |
| InChIKey | KPIGTGLSWKPOCM-UHFFFAOYSA-N |
| XLogP | -4.70 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.18 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|