C22H28N2+2 — CID 72724908
1-(8-pyridin-1-ium-1-yloctyl)quinolin-1-ium (PubChem CID 72724908) has the molecular formula C22H28N2+2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-(8-pyridin-1-ium-1-yloctyl)quinolin-1-ium.
| Compound Name | 1-(8-pyridin-1-ium-1-yloctyl)quinolin-1-ium |
|---|---|
| PubChem CID | 72724908 |
| Molecular Formula | C22H28N2+2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-(8-pyridin-1-ium-1-yloctyl)quinolin-1-ium |
| SMILES | c1cc[n+](CCCCCCCC[n+]2cccc3ccccc32)cc1 |
| InChI | InChI=1S/C22H28N2/c1(3-8-16-23-17-9-5-10-18-23)2-4-11-19-24-20-12-14-21-13-6-7-15-22(21)24/h5-7,9-10,12-15,17-18,20H,1-4,8,11,16,19H2/q+2 |
| InChIKey | VLINJGAWQXONRY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|