C23H24Cl4I2N2 — CID 13422438
CID 13422438 (PubChem CID 13422438) has the molecular formula C23H24Cl4I2N2 and a molecular weight of 724.08 g/mol.
| Compound Name | CID 13422438 |
|---|---|
| PubChem CID | 13422438 |
| Molecular Formula | C23H24Cl4I2N2 |
| Molecular Weight | 724.08 g/mol |
| Exact Mass | 721.88 |
| IUPAC Name | — |
| SMILES | Cl[I-]Cl.Cl[I-]Cl.c1ccc2c(c1)ccc[n+]2CCCCC[n+]1cccc2ccccc21 |
| InChI | InChI=1S/C23H24N2.2Cl2I/c1(6-16-24-18-8-12-20-10-2-4-14-22(20)24)7-17-25-19-9-13-21-11-3-5-15-23(21)25;2*1-3-2/h2-5,8-15,18-19H,1,6-7,16-17H2;;/q+2;2*-1 |
| InChIKey | BQCXKXZSARPFOR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|