C12H12Cl2N+ — CID 3284272
1-(2,3-dichloropropyl)quinolin-1-ium (PubChem CID 3284272) has the molecular formula C12H12Cl2N+ and a molecular weight of 241.14 g/mol. Its IUPAC name is 1-(2,3-dichloropropyl)quinolin-1-ium.
| Compound Name | 1-(2,3-dichloropropyl)quinolin-1-ium |
|---|---|
| PubChem CID | 3284272 |
| Molecular Formula | C12H12Cl2N+ |
| Molecular Weight | 241.14 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1-(2,3-dichloropropyl)quinolin-1-ium |
| SMILES | ClCC(Cl)C[n+]1cccc2ccccc21 |
| InChI | InChI=1S/C12H12Cl2N/c13-8-11(14)9-15-7-3-5-10-4-1-2-6-12(10)15/h1-7,11H,8-9H2/q+1 |
| InChIKey | XFASQQKPHAOGMP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|