C11H11Cl2NO4 — CID 44887346
1-(2-chloroethyl)quinolin-1-ium perchlorate (PubChem CID 44887346) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1-(2-chloroethyl)quinolin-1-ium perchlorate.
| Compound Name | 1-(2-chloroethyl)quinolin-1-ium perchlorate |
|---|---|
| PubChem CID | 44887346 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 1-(2-chloroethyl)quinolin-1-ium perchlorate |
| SMILES | ClCC[n+]1cccc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H11ClN.ClHO4/c12-7-9-13-8-3-5-10-4-1-2-6-11(10)13;2-1(3,4)5/h1-6,8H,7,9H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | FVCNLZFAFXJASR-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|