C29H42N4S+2 — CID 89323987
N,N-dibutyl-4-[(E)-2-[1-[3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropyl]pyridin-1-ium-2-yl]ethenyl]aniline (PubChem CID 89323987) has the molecular formula C29H42N4S+2 and a molecular weight of 478.75 g/mol. Its IUPAC name is N,N-dibutyl-4-[(E)-2-[1-[3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropyl]pyridin-1-ium-2-yl]ethenyl]aniline.
| Compound Name | N,N-dibutyl-4-[(E)-2-[1-[3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropyl]pyridin-1-ium-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 89323987 |
| Molecular Formula | C29H42N4S+2 |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | N,N-dibutyl-4-[(E)-2-[1-[3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropyl]pyridin-1-ium-2-yl]ethenyl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2cccc[n+]2CCCSc2n(C)cc[n+]2C)cc1 |
| InChI | InChI=1S/C29H42N4S/c1-5-7-19-32(20-8-6-2)28-17-14-26(15-18-28)13-16-27-12-9-10-21-33(27)22-11-25-34-29-30(3)23-24-31(29)4/h9-10,12-18,21,23-24H,5-8,11,19-20,22,25H2,1-4H3/q+2 |
| InChIKey | WEKVHPXGOPTPHH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 15.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|