C17H17N2S+ — CID 23787849
2-[2-[(E)-2-(1-benzothiophen-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 23787849) has the molecular formula C17H17N2S+ and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[2-[(E)-2-(1-benzothiophen-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
| Compound Name | 2-[2-[(E)-2-(1-benzothiophen-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 23787849 |
| Molecular Formula | C17H17N2S+ |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-[2-[(E)-2-(1-benzothiophen-3-yl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | NCC[n+]1ccccc1/C=C/c1csc2ccccc12 |
| InChI | InChI=1S/C17H17N2S/c18-10-12-19-11-4-3-5-15(19)9-8-14-13-20-17-7-2-1-6-16(14)17/h1-9,11,13H,10,12,18H2/q+1/b9-8+ |
| InChIKey | UXTIFMJOUIABOY-CMDGGOBGSA-N |
| XLogP | 3.32 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|