C10H6Br2S — CID 130532128
3-(2,2-dibromoethenyl)-1-benzothiophene (PubChem CID 130532128) has the molecular formula C10H6Br2S and a molecular weight of 318.03 g/mol. Its IUPAC name is 3-(2,2-dibromoethenyl)-1-benzothiophene.
| Compound Name | 3-(2,2-dibromoethenyl)-1-benzothiophene |
|---|---|
| PubChem CID | 130532128 |
| Molecular Formula | C10H6Br2S |
| Molecular Weight | 318.03 g/mol |
| Exact Mass | 315.86 |
| IUPAC Name | 3-(2,2-dibromoethenyl)-1-benzothiophene |
| SMILES | BrC(Br)=Cc1csc2ccccc12 |
| InChI | InChI=1S/C10H6Br2S/c11-10(12)5-7-6-13-9-4-2-1-3-8(7)9/h1-6H |
| InChIKey | SLLBWMZVOBDEGR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.03 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |