C14H12O2S — CID 138594037
3-(1-benzothiophen-3-ylmethylidene)pentane-2,4-dione (PubChem CID 138594037) has the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-ylmethylidene)pentane-2,4-dione.
| Compound Name | 3-(1-benzothiophen-3-ylmethylidene)pentane-2,4-dione |
|---|---|
| PubChem CID | 138594037 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-(1-benzothiophen-3-ylmethylidene)pentane-2,4-dione |
| SMILES | CC(=O)C(=Cc1csc2ccccc12)C(C)=O |
| InChI | InChI=1S/C14H12O2S/c1-9(15)13(10(2)16)7-11-8-17-14-6-4-3-5-12(11)14/h3-8H,1-2H3 |
| InChIKey | QZWJMTFTDHLEDY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|