C15H16O4S — CID 176649625
ethyl (E,2S,3R)-5-(1-benzothiophen-3-yl)-2,3-dihydroxypent-4-enoate (PubChem CID 176649625) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is ethyl (E,2S,3R)-5-(1-benzothiophen-3-yl)-2,3-dihydroxypent-4-enoate.
| Compound Name | ethyl (E,2S,3R)-5-(1-benzothiophen-3-yl)-2,3-dihydroxypent-4-enoate |
|---|---|
| PubChem CID | 176649625 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | ethyl (E,2S,3R)-5-(1-benzothiophen-3-yl)-2,3-dihydroxypent-4-enoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)/C=C/c1csc2ccccc12 |
| InChI | InChI=1S/C15H16O4S/c1-2-19-15(18)14(17)12(16)8-7-10-9-20-13-6-4-3-5-11(10)13/h3-9,12,14,16-17H,2H2,1H3/b8-7+/t12-,14+/m1/s1 |
| InChIKey | KHJAQRMZKLAUPI-KHAURHHGSA-N |
| XLogP | 2.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |