C14H18O4 — CID 176649639
ethyl (E,2S,3R)-2,3-dihydroxy-5-(4-methylphenyl)pent-4-enoate (PubChem CID 176649639) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl (E,2S,3R)-2,3-dihydroxy-5-(4-methylphenyl)pent-4-enoate.
| Compound Name | ethyl (E,2S,3R)-2,3-dihydroxy-5-(4-methylphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 176649639 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl (E,2S,3R)-2,3-dihydroxy-5-(4-methylphenyl)pent-4-enoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O4/c1-3-18-14(17)13(16)12(15)9-8-11-6-4-10(2)5-7-11/h4-9,12-13,15-16H,3H2,1-2H3/b9-8+/t12-,13+/m1/s1 |
| InChIKey | SKARSDTYFZTOID-VSONXHSHSA-N |
| XLogP | 1.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |