C15H10N2S2 — CID 126805931
3-(1-benzothiophen-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 126805931) has the molecular formula C15H10N2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(1-benzothiophen-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126805931 |
| Molecular Formula | C15H10N2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(C(C#N)=Cc2csc3ccccc23)n1 |
| InChI | InChI=1S/C15H10N2S2/c1-10-8-19-15(17-10)11(7-16)6-12-9-18-14-5-3-2-4-13(12)14/h2-6,8-9H,1H3 |
| InChIKey | XOAQJGGYMNTBMZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|