C16H16N2S — CID 9342407
(E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enenitrile (PubChem CID 9342407) has the molecular formula C16H16N2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9342407 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/c2cc(C)c(C)cc2C)n1 |
| InChI | InChI=1S/C16H16N2S/c1-10-5-12(3)14(6-11(10)2)7-15(8-17)16-18-13(4)9-19-16/h5-7,9H,1-4H3/b15-7+ |
| InChIKey | AYUZMYPUEDEOJI-VIZOYTHASA-N |
| XLogP | 4.44 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|