C16H12N4S — CID 8812233
(E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(quinolin-5-ylamino)prop-2-enenitrile (PubChem CID 8812233) has the molecular formula C16H12N4S and a molecular weight of 292.37 g/mol. Its IUPAC name is (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(quinolin-5-ylamino)prop-2-enenitrile.
| Compound Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(quinolin-5-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 8812233 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(quinolin-5-ylamino)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2cccc3ncccc23)n1 |
| InChI | InChI=1S/C16H12N4S/c1-11-10-21-16(20-11)12(8-17)9-19-15-6-2-5-14-13(15)4-3-7-18-14/h2-7,9-10,19H,1H3/b12-9+ |
| InChIKey | XZJZBMDTHWHLIA-FMIVXFBMSA-N |
| XLogP | 3.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|