C15H14N4OS2 — CID 8821708
2-[2-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]phenyl]sulfanylacetamide (PubChem CID 8821708) has the molecular formula C15H14N4OS2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 2-[2-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 8821708 |
| Molecular Formula | C15H14N4OS2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[2-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]phenyl]sulfanylacetamide |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccccc2SCC(N)=O)n1 |
| InChI | InChI=1S/C15H14N4OS2/c1-10-8-22-15(19-10)11(6-16)7-18-12-4-2-3-5-13(12)21-9-14(17)20/h2-5,7-8,18H,9H2,1H3,(H2,17,20)/b11-7+ |
| InChIKey | ZTMLXWNTRLRTSU-YRNVUSSQSA-N |
| XLogP | 3.01 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|