C12H13N5S — CID 8812624
(E)-3-[(2-ethylpyrazol-3-yl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8812624) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is (E)-3-[(2-ethylpyrazol-3-yl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[(2-ethylpyrazol-3-yl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8812624 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (E)-3-[(2-ethylpyrazol-3-yl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCn1nccc1N/C=C(\C#N)c1nc(C)cs1 |
| InChI | InChI=1S/C12H13N5S/c1-3-17-11(4-5-15-17)14-7-10(6-13)12-16-9(2)8-18-12/h4-5,7-8,14H,3H2,1-2H3/b10-7+ |
| InChIKey | JSDQUCVJZPVSGU-JXMROGBWSA-N |
| XLogP | 2.64 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|