C21H25N5O2S — CID 8812608
(E)-3-(2,4-dimorpholin-4-ylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8812608) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is (E)-3-(2,4-dimorpholin-4-ylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,4-dimorpholin-4-ylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8812608 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (E)-3-(2,4-dimorpholin-4-ylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccc(N3CCOCC3)cc2N2CCOCC2)n1 |
| InChI | InChI=1S/C21H25N5O2S/c1-16-15-29-21(24-16)17(13-22)14-23-19-3-2-18(25-4-8-27-9-5-25)12-20(19)26-6-10-28-11-7-26/h2-3,12,14-15,23H,4-11H2,1H3/b17-14+ |
| InChIKey | XDTKFNPUVVJDAG-SAPNQHFASA-N |
| XLogP | 3.10 |
| TPSA | 73.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|