C16H19N3O2S — CID 110675165
N-(4-methyl-1,3-thiazol-2-yl)-2-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 110675165) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110675165 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1csc(NC(=O)Cc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C16H19N3O2S/c1-12-11-22-16(17-12)18-15(20)10-13-2-4-14(5-3-13)19-6-8-21-9-7-19/h2-5,11H,6-10H2,1H3,(H,17,18,20) |
| InChIKey | YPRBJTALILHQES-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|