C16H20N2OS — CID 30273255
2-(4-butylphenyl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 30273255) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-(4-butylphenyl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-butylphenyl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 30273255 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-(4-butylphenyl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCc1ccc(CC(=O)Nc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C16H20N2OS/c1-3-4-5-13-6-8-14(9-7-13)10-15(19)18-16-17-12(2)11-20-16/h6-9,11H,3-5,10H2,1-2H3,(H,17,18,19) |
| InChIKey | NUBLWAYXMWTCJR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |