C25H29N5O3S — CID 55439428
2-[methyl-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55439428) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 2-[methyl-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[methyl-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55439428 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-[methyl-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CN(C)CC(=O)Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H29N5O3S/c1-18-3-5-19(6-4-18)22-17-34-25(27-22)28-24(32)16-29(2)15-23(31)26-20-7-9-21(10-8-20)30-11-13-33-14-12-30/h3-10,17H,11-16H2,1-2H3,(H,26,31)(H,27,28,32) |
| InChIKey | OUYKVELKYRLWER-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|