C24H24N4O2S — CID 121038811
2-[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 121038811) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 121038811 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc(-c2cn3c(CC(=O)Nc4ccc(N5CCOCC5)cc4)csc3n2)cc1 |
| InChI | InChI=1S/C24H24N4O2S/c1-17-2-4-18(5-3-17)22-15-28-21(16-31-24(28)26-22)14-23(29)25-19-6-8-20(9-7-19)27-10-12-30-13-11-27/h2-9,15-16H,10-14H2,1H3,(H,25,29) |
| InChIKey | MHOWUAHJSIHGBJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|