C42H57I2N4+ — CID 159252342
4-[(E)-2-[1-[10-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methylpyridin-1-ium-1-yl]decyl]-3-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline;iodide;hydroiodide (PubChem CID 159252342) has the molecular formula C42H57I2N4+ and a molecular weight of 871.75 g/mol. Its IUPAC name is 4-[(E)-2-[1-[10-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methylpyridin-1-ium-1-yl]decyl]-3-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline;iodide;hydroiodide.
| Compound Name | 4-[(E)-2-[1-[10-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methylpyridin-1-ium-1-yl]decyl]-3-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline;iodide;hydroiodide |
|---|---|
| PubChem CID | 159252342 |
| Molecular Formula | C42H57I2N4+ |
| Molecular Weight | 871.75 g/mol |
| Exact Mass | 871.27 |
| IUPAC Name | 4-[(E)-2-[1-[10-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methylpyridin-1-ium-1-yl]decyl]-3-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline;iodide;hydroiodide |
| SMILES | Cc1c[n+](CCCCCCCCCC[n+]2ccc(/C=C/c3ccc(N(C)C)cc3)c(C)c2)ccc1/C=C/c1ccc(N(C)C)cc1.I.[I-] |
| InChI | InChI=1S/C42H56N4.2HI/c1-35-33-45(31-27-39(35)21-15-37-17-23-41(24-18-37)43(3)4)29-13-11-9-7-8-10-12-14-30-46-32-28-40(36(2)34-46)22-16-38-19-25-42(26-20-38)44(5)6;;/h15-28,31-34H,7-14,29-30H2,1-6H3;2*1H/q+2;;/p-1 |
| InChIKey | UXIUXULLHZIZDP-UHFFFAOYSA-M |
| XLogP | 6.79 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.75 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|