C17H18ClNO4 — CID 82026061
2-[2-[(E)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid chloride (PubChem CID 82026061) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-[2-[(E)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid chloride.
| Compound Name | 2-[2-[(E)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid chloride |
|---|---|
| PubChem CID | 82026061 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[2-[(E)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]acetic acid chloride |
| SMILES | CCOc1cc(/C=C/c2cccc[n+]2CC(=O)O)ccc1O.[Cl-] |
| InChI | InChI=1S/C17H17NO4.ClH/c1-2-22-16-11-13(7-9-15(16)19)6-8-14-5-3-4-10-18(14)12-17(20)21;/h3-11H,2,12H2,1H3,(H,20,21);1H |
| InChIKey | FBFHPEUNYWBXBB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|