C16H14BrCl2NO — CID 11014538
1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one bromide (PubChem CID 11014538) has the molecular formula C16H14BrCl2NO and a molecular weight of 387.10 g/mol. Its IUPAC name is 1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one bromide.
| Compound Name | 1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one bromide |
|---|---|
| PubChem CID | 11014538 |
| Molecular Formula | C16H14BrCl2NO |
| Molecular Weight | 387.10 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one bromide |
| SMILES | CC(=O)C[n+]1ccccc1/C=C/c1ccc(Cl)c(Cl)c1.[Br-] |
| InChI | InChI=1S/C16H14Cl2NO.BrH/c1-12(20)11-19-9-3-2-4-14(19)7-5-13-6-8-15(17)16(18)10-13;/h2-10H,11H2,1H3;1H/q+1;/p-1/b7-5+; |
| InChIKey | CEAAVCGAKOWDPC-GZOLSCHFSA-M |
| XLogP | 1.04 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.10 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|