C16H11Cl2NO3 — CID 71556430
N-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-hydroxybenzamide (PubChem CID 71556430) has the molecular formula C16H11Cl2NO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is N-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-hydroxybenzamide.
| Compound Name | N-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71556430 |
| Molecular Formula | C16H11Cl2NO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-2-hydroxybenzamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NC(=O)c1ccccc1O |
| InChI | InChI=1S/C16H11Cl2NO3/c17-12-7-5-10(9-13(12)18)6-8-15(21)19-16(22)11-3-1-2-4-14(11)20/h1-9,20H,(H,19,21,22)/b8-6+ |
| InChIKey | OEQAKMJRLAHDGX-SOFGYWHQSA-N |
| XLogP | 3.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|