C15H12Cl2 — CID 129289672
1,2-dichloro-4-[(Z)-2-(4-methylphenyl)ethenyl]benzene (PubChem CID 129289672) has the molecular formula C15H12Cl2 and a molecular weight of 263.17 g/mol. Its IUPAC name is 1,2-dichloro-4-[(Z)-2-(4-methylphenyl)ethenyl]benzene.
| Compound Name | 1,2-dichloro-4-[(Z)-2-(4-methylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 129289672 |
| Molecular Formula | C15H12Cl2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 1,2-dichloro-4-[(Z)-2-(4-methylphenyl)ethenyl]benzene |
| SMILES | Cc1ccc(/C=C\c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H12Cl2/c1-11-2-4-12(5-3-11)6-7-13-8-9-14(16)15(17)10-13/h2-10H,1H3/b7-6- |
| InChIKey | UVAQXNACTBHPAN-SREVYHEPSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|