C30H18Cl4N2O — CID 102039656
2,5-bis[4-[(E)-2-(3,4-dichlorophenyl)ethenyl]phenyl]-1,3,4-oxadiazole (PubChem CID 102039656) has the molecular formula C30H18Cl4N2O and a molecular weight of 564.30 g/mol. Its IUPAC name is 2,5-bis[4-[(E)-2-(3,4-dichlorophenyl)ethenyl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2,5-bis[4-[(E)-2-(3,4-dichlorophenyl)ethenyl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102039656 |
| Molecular Formula | C30H18Cl4N2O |
| Molecular Weight | 564.30 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 2,5-bis[4-[(E)-2-(3,4-dichlorophenyl)ethenyl]phenyl]-1,3,4-oxadiazole |
| SMILES | Clc1ccc(/C=C/c2ccc(-c3nnc(-c4ccc(/C=C/c5ccc(Cl)c(Cl)c5)cc4)o3)cc2)cc1Cl |
| InChI | InChI=1S/C30H18Cl4N2O/c31-25-15-9-21(17-27(25)33)3-1-19-5-11-23(12-6-19)29-35-36-30(37-29)24-13-7-20(8-14-24)2-4-22-10-16-26(32)28(34)18-22/h1-18H/b3-1+,4-2+ |
| InChIKey | NXMNTIZPUBJXCZ-ZPUQHVIOSA-N |
| XLogP | 10.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.30 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|