C16H14Cl2O — CID 71463708
4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2,6-dimethylphenol (PubChem CID 71463708) has the molecular formula C16H14Cl2O and a molecular weight of 293.19 g/mol. Its IUPAC name is 4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2,6-dimethylphenol.
| Compound Name | 4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 71463708 |
| Molecular Formula | C16H14Cl2O |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(/C=C/c2ccc(Cl)c(Cl)c2)cc(C)c1O |
| InChI | InChI=1S/C16H14Cl2O/c1-10-7-13(8-11(2)16(10)19)4-3-12-5-6-14(17)15(18)9-12/h3-9,19H,1-2H3/b4-3+ |
| InChIKey | XGRLKQOXIRQCDR-ONEGZZNKSA-N |
| XLogP | 5.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|