C16H14Cl2NO+ — CID 11014539
1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one (PubChem CID 11014539) has the molecular formula C16H14Cl2NO+ and a molecular weight of 307.20 g/mol. Its IUPAC name is 1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one.
| Compound Name | 1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one |
|---|---|
| PubChem CID | 11014539 |
| Molecular Formula | C16H14Cl2NO+ |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 1-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]propan-2-one |
| SMILES | CC(=O)C[n+]1ccccc1/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2NO/c1-12(20)11-19-9-3-2-4-14(19)7-5-13-6-8-15(17)16(18)10-13/h2-10H,11H2,1H3/q+1/b7-5+ |
| InChIKey | JIBAMAKLSBWPRQ-FNORWQNLSA-N |
| XLogP | 4.04 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|