About [3,5-bis(trifluoromethyl)phenyl]-tributylazanium
[3,5-bis(trifluoromethyl)phenyl]-tributylazanium (PubChem CID 158527583) has the molecular formula C20H30F6N+
and a molecular weight of 398.46 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-tributylazanium.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-tributylazanium |
| PubChem CID | 158527583 |
| Molecular Formula | C20H30F6N+ |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-tributylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H30F6N/c1-4-7-10-27(11-8-5-2,12-9-6-3)18-14-16(19(21,22)23)13-17(15-18)20(24,25)26/h13-15H,4-12H2,1-3H3/q+1 |
| InChIKey | DXSMQCNFZKKKBY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(trifluoromethyl)phenyl]-tributylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-tributylazanium?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-tributylazanium (CID 158527583) is [3,5-bis(trifluoromethyl)phenyl]-tributylazanium.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl]-tributylazanium?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl]-tributylazanium is CCCC[N+](CCCC)(CCCC)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl]-tributylazanium?
The InChIKey is DXSMQCNFZKKKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30F6N/c1-4-7-10-27(11-8-5-2,12-9-6-3)18-14-16(19(21,22)23)13-17(15-18)20(24,25)26/h13-15H,4-12H2,1-3H3/q+1.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl]-tributylazanium?
[3,5-bis(trifluoromethyl)phenyl]-tributylazanium has a molecular weight of 398.46 g/mol, XLogP of 7.43, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl]-tributylazanium is sourced from PubChem (CID 158527583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).