C27H30F6NO+ — CID 162537072
[3,5-bis(trifluoromethyl)phenyl]methyl-butyl-[(2S)-2-hydroxypropyl]-(naphthalen-2-ylmethyl)azanium (PubChem CID 162537072) has the molecular formula C27H30F6NO+ and a molecular weight of 498.53 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl-butyl-[(2S)-2-hydroxypropyl]-(naphthalen-2-ylmethyl)azanium.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl-butyl-[(2S)-2-hydroxypropyl]-(naphthalen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 162537072 |
| Molecular Formula | C27H30F6NO+ |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl-butyl-[(2S)-2-hydroxypropyl]-(naphthalen-2-ylmethyl)azanium |
| SMILES | CCCC[N+](Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(Cc1ccc2ccccc2c1)C[C@H](C)O |
| InChI | InChI=1S/C27H30F6NO/c1-3-4-11-34(16-19(2)35,17-20-9-10-22-7-5-6-8-23(22)12-20)18-21-13-24(26(28,29)30)15-25(14-21)27(31,32)33/h5-10,12-15,19,35H,3-4,11,16-18H2,1-2H3/q+1/t19-,34?/m0/s1 |
| InChIKey | IYNLQEWSBLNURJ-IZPSYREMSA-N |
| XLogP | 7.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|