C23H39F3N+ — CID 13080634
tris(3-methylbutyl)-[[3-(trifluoromethyl)phenyl]methyl]azanium (PubChem CID 13080634) has the molecular formula C23H39F3N+ and a molecular weight of 386.57 g/mol. Its IUPAC name is tris(3-methylbutyl)-[[3-(trifluoromethyl)phenyl]methyl]azanium.
| Compound Name | tris(3-methylbutyl)-[[3-(trifluoromethyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 13080634 |
| Molecular Formula | C23H39F3N+ |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | tris(3-methylbutyl)-[[3-(trifluoromethyl)phenyl]methyl]azanium |
| SMILES | CC(C)CC[N+](CCC(C)C)(CCC(C)C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H39F3N/c1-18(2)10-13-27(14-11-19(3)4,15-12-20(5)6)17-21-8-7-9-22(16-21)23(24,25)26/h7-9,16,18-20H,10-15,17H2,1-6H3/q+1 |
| InChIKey | GJNDCOHPMCQBBM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|