C32H29ClF3NO — CID 139950618
(2-hydroxy-1,2-dinaphthalen-2-ylethyl)-dimethyl-[[4-(trifluoromethyl)phenyl]methyl]azanium chloride (PubChem CID 139950618) has the molecular formula C32H29ClF3NO and a molecular weight of 536.04 g/mol. Its IUPAC name is (2-hydroxy-1,2-dinaphthalen-2-ylethyl)-dimethyl-[[4-(trifluoromethyl)phenyl]methyl]azanium chloride.
| Compound Name | (2-hydroxy-1,2-dinaphthalen-2-ylethyl)-dimethyl-[[4-(trifluoromethyl)phenyl]methyl]azanium chloride |
|---|---|
| PubChem CID | 139950618 |
| Molecular Formula | C32H29ClF3NO |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | (2-hydroxy-1,2-dinaphthalen-2-ylethyl)-dimethyl-[[4-(trifluoromethyl)phenyl]methyl]azanium chloride |
| SMILES | C[N+](C)(Cc1ccc(C(F)(F)F)cc1)C(c1ccc2ccccc2c1)C(O)c1ccc2ccccc2c1.[Cl-] |
| InChI | InChI=1S/C32H29F3NO.ClH/c1-36(2,21-22-11-17-29(18-12-22)32(33,34)35)30(27-15-13-23-7-3-5-9-25(23)19-27)31(37)28-16-14-24-8-4-6-10-26(24)20-28;/h3-20,30-31,37H,21H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SIBFUOBLYJQYGT-UHFFFAOYSA-M |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|