C16H19F6NO — CID 102482272
2-[3,5-bis(trifluoromethyl)phenyl]-N-butyl-2-methylpropanamide (PubChem CID 102482272) has the molecular formula C16H19F6NO and a molecular weight of 355.32 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-butyl-2-methylpropanamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-butyl-2-methylpropanamide |
|---|---|
| PubChem CID | 102482272 |
| Molecular Formula | C16H19F6NO |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-butyl-2-methylpropanamide |
| SMILES | CCCCNC(=O)C(C)(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F6NO/c1-4-5-6-23-13(24)14(2,3)10-7-11(15(17,18)19)9-12(8-10)16(20,21)22/h7-9H,4-6H2,1-3H3,(H,23,24) |
| InChIKey | DQNUSGIBDDZOLT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|