C14H14F6N2OS — CID 17385638
N-[3,5-bis(trifluoromethyl)phenyl]-2-(butylamino)-2-sulfanylideneacetamide (PubChem CID 17385638) has the molecular formula C14H14F6N2OS and a molecular weight of 372.33 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(butylamino)-2-sulfanylideneacetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(butylamino)-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 17385638 |
| Molecular Formula | C14H14F6N2OS |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(butylamino)-2-sulfanylideneacetamide |
| SMILES | CCCCNC(=S)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F6N2OS/c1-2-3-4-21-12(24)11(23)22-10-6-8(13(15,16)17)5-9(7-10)14(18,19)20/h5-7H,2-4H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | UKNRNGYHDDWDAV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|