C25H22F6N4O2S — CID 74539841
4-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-butylpyridine-2-carboxamide (PubChem CID 74539841) has the molecular formula C25H22F6N4O2S and a molecular weight of 556.53 g/mol. Its IUPAC name is 4-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-butylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-butylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 74539841 |
| Molecular Formula | C25H22F6N4O2S |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 4-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenoxy]-N-butylpyridine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Oc2ccc(NC(=S)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C25H22F6N4O2S/c1-2-3-9-33-22(36)21-14-20(8-10-32-21)37-19-6-4-17(5-7-19)34-23(38)35-18-12-15(24(26,27)28)11-16(13-18)25(29,30)31/h4-8,10-14H,2-3,9H2,1H3,(H,33,36)(H2,34,35,38) |
| InChIKey | ZXFGRPIZSZOFMB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|