C17H14F6N2OS2 — CID 139833864
2-[3,5-bis(trifluoromethyl)anilino]-N-[(4-ethylthiophen-2-yl)methyl]-2-sulfanylideneacetamide (PubChem CID 139833864) has the molecular formula C17H14F6N2OS2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)anilino]-N-[(4-ethylthiophen-2-yl)methyl]-2-sulfanylideneacetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)anilino]-N-[(4-ethylthiophen-2-yl)methyl]-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 139833864 |
| Molecular Formula | C17H14F6N2OS2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)anilino]-N-[(4-ethylthiophen-2-yl)methyl]-2-sulfanylideneacetamide |
| SMILES | CCc1csc(CNC(=O)C(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H14F6N2OS2/c1-2-9-3-13(28-8-9)7-24-14(26)15(27)25-12-5-10(16(18,19)20)4-11(6-12)17(21,22)23/h3-6,8H,2,7H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | UGQCGUVPDBYAHM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|