C15H13F3N2O3S — CID 139833835
N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 139833835) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 139833835 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCc2cccs2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-23-11-6-9(15(16,17)18)5-10(7-11)20-14(22)13(21)19-8-12-3-2-4-24-12/h2-7H,8H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | FPOIOSQGZOJSRF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|