C14H13N3O5S — CID 139833853
N'-(3-methoxy-5-nitrophenyl)-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 139833853) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is N'-(3-methoxy-5-nitrophenyl)-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-(3-methoxy-5-nitrophenyl)-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 139833853 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N'-(3-methoxy-5-nitrophenyl)-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCc2cccs2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O5S/c1-22-11-6-9(5-10(7-11)17(20)21)16-14(19)13(18)15-8-12-3-2-4-23-12/h2-7H,8H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | STZHRGWNOJRUSR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|