C19H16N2O4S2 — CID 121131867
N'-(3-methoxyphenyl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]oxamide (PubChem CID 121131867) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N'-(3-methoxyphenyl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]oxamide.
| Compound Name | N'-(3-methoxyphenyl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 121131867 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N'-(3-methoxyphenyl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)NCc2ccc(C(=O)c3cccs3)s2)c1 |
| InChI | InChI=1S/C19H16N2O4S2/c1-25-13-5-2-4-12(10-13)21-19(24)18(23)20-11-14-7-8-16(27-14)17(22)15-6-3-9-26-15/h2-10H,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | NRGAMPVHRPVMPY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|