C15H11F6NO2S — CID 2110784
2-[3,5-bis(trifluoromethyl)phenoxy]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 2110784) has the molecular formula C15H11F6NO2S and a molecular weight of 383.31 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2110784 |
| Molecular Formula | C15H11F6NO2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(COc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NCc1cccs1 |
| InChI | InChI=1S/C15H11F6NO2S/c16-14(17,18)9-4-10(15(19,20)21)6-11(5-9)24-8-13(23)22-7-12-2-1-3-25-12/h1-6H,7-8H2,(H,22,23) |
| InChIKey | AWGRHYBMHDIBBO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |