C18H22F6N2O2 — CID 108524560
N-[3,5-bis(trifluoromethyl)phenyl]-N',N'-dibutyloxamide (PubChem CID 108524560) has the molecular formula C18H22F6N2O2 and a molecular weight of 412.37 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N',N'-dibutyloxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N',N'-dibutyloxamide |
|---|---|
| PubChem CID | 108524560 |
| Molecular Formula | C18H22F6N2O2 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N',N'-dibutyloxamide |
| SMILES | CCCCN(CCCC)C(=O)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H22F6N2O2/c1-3-5-7-26(8-6-4-2)16(28)15(27)25-14-10-12(17(19,20)21)9-13(11-14)18(22,23)24/h9-11H,3-8H2,1-2H3,(H,25,27) |
| InChIKey | AZSUWYDCOVHWBA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|