C19H24F6N2OS — CID 166152877
1-[3,5-bis(trifluoromethyl)phenyl]-3-(7,7-dimethyl-6-oxooctyl)thiourea (PubChem CID 166152877) has the molecular formula C19H24F6N2OS and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(7,7-dimethyl-6-oxooctyl)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(7,7-dimethyl-6-oxooctyl)thiourea |
|---|---|
| PubChem CID | 166152877 |
| Molecular Formula | C19H24F6N2OS |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(7,7-dimethyl-6-oxooctyl)thiourea |
| SMILES | CC(C)(C)C(=O)CCCCCNC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F6N2OS/c1-17(2,3)15(28)7-5-4-6-8-26-16(29)27-14-10-12(18(20,21)22)9-13(11-14)19(23,24)25/h9-11H,4-8H2,1-3H3,(H2,26,27,29) |
| InChIKey | DTEVNLWUSMVZLQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|