C17H23F3N2OS — CID 166152873
1-(7,7-dimethyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea (PubChem CID 166152873) has the molecular formula C17H23F3N2OS and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-(7,7-dimethyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea.
| Compound Name | 1-(7,7-dimethyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 166152873 |
| Molecular Formula | C17H23F3N2OS |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-(7,7-dimethyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea |
| SMILES | CC(C)(C)C(=O)CCCCCNC(=S)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C17H23F3N2OS/c1-17(2,3)14(23)7-5-4-6-8-21-16(24)22-15-12(19)9-11(18)10-13(15)20/h9-10H,4-8H2,1-3H3,(H2,21,22,24) |
| InChIKey | CTBDJPAZIWHDAK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|