C16H25F3N2OS — CID 166152884
1-(7-methyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea;molecular hydrogen (PubChem CID 166152884) has the molecular formula C16H25F3N2OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(7-methyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea;molecular hydrogen.
| Compound Name | 1-(7-methyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea;molecular hydrogen |
|---|---|
| PubChem CID | 166152884 |
| Molecular Formula | C16H25F3N2OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-(7-methyl-6-oxooctyl)-3-(2,4,6-trifluorophenyl)thiourea;molecular hydrogen |
| SMILES | CC(C)C(=O)CCCCCNC(=S)Nc1c(F)cc(F)cc1F.[H][H].[H][H] |
| InChI | InChI=1S/C16H21F3N2OS.2H2/c1-10(2)14(22)6-4-3-5-7-20-16(23)21-15-12(18)8-11(17)9-13(15)19;;/h8-10H,3-7H2,1-2H3,(H2,20,21,23);2*1H |
| InChIKey | USFHAXHJDBXLDU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|