About 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen
1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen (PubChem CID 166152879) has the molecular formula C16H25F3N2OS
and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen |
| PubChem CID | 166152879 |
| Molecular Formula | C16H25F3N2OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen |
| SMILES | CC(C)C(=O)CCCCCNC(=S)Nc1cc(F)c(F)cc1F.[H][H].[H][H] |
| InChI | InChI=1S/C16H21F3N2OS.2H2/c1-10(2)15(22)6-4-3-5-7-20-16(23)21-14-9-12(18)11(17)8-13(14)19;;/h8-10H,3-7H2,1-2H3,(H2,20,21,23);2*1H |
| InChIKey | DYPZATGJRVMXNQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen?
The IUPAC name of 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen (CID 166152879) is 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen.
What is the SMILES notation for 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen?
The canonical SMILES for 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen is CC(C)C(=O)CCCCCNC(=S)Nc1cc(F)c(F)cc1F.[H][H].[H][H].
What is the InChIKey of 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen?
The InChIKey is DYPZATGJRVMXNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3N2OS.2H2/c1-10(2)15(22)6-4-3-5-7-20-16(23)21-14-9-12(18)11(17)8-13(14)19;;/h8-10H,3-7H2,1-2H3,(H2,20,21,23);2*1H.
What are the key properties of 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen?
1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen has a molecular weight of 350.45 g/mol, XLogP of 4.67, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-methyl-6-oxooctyl)-3-(2,4,5-trifluorophenyl)thiourea;molecular hydrogen is sourced from PubChem (CID 166152879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).