C12H15BrF2N2OS — CID 115570838
1-(2-bromo-4,6-difluorophenyl)-3-(3-ethoxypropyl)thiourea (PubChem CID 115570838) has the molecular formula C12H15BrF2N2OS and a molecular weight of 353.23 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 115570838 |
| Molecular Formula | C12H15BrF2N2OS |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H15BrF2N2OS/c1-2-18-5-3-4-16-12(19)17-11-9(13)6-8(14)7-10(11)15/h6-7H,2-5H2,1H3,(H2,16,17,19) |
| InChIKey | WSIVNENOLCPLDH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|